C16H8F6N2S — CID 57390180
3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-thiadiazole (PubChem CID 57390180) has the molecular formula C16H8F6N2S and a molecular weight of 374.31 g/mol. Its IUPAC name is 3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-thiadiazole.
| Compound Name | 3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 57390180 |
| Molecular Formula | C16H8F6N2S |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 3,5-bis[2-(trifluoromethyl)phenyl]-1,2,4-thiadiazole |
| SMILES | FC(F)(F)c1ccccc1-c1nsc(-c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C16H8F6N2S/c17-15(18,19)11-7-3-1-5-9(11)13-23-14(25-24-13)10-6-2-4-8-12(10)16(20,21)22/h1-8H |
| InChIKey | MPDMGOZKRDEWLI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |