C20H23N3O2 — CID 57390253
methyl 9-(3-imidazol-1-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57390253) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 9-(3-imidazol-1-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-(3-imidazol-1-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57390253 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | methyl 9-(3-imidazol-1-ylpropyl)-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCCn2ccnc2)CCCC1 |
| InChI | InChI=1S/C20H23N3O2/c1-25-20(24)15-7-8-19-17(13-15)16-5-2-3-6-18(16)23(19)11-4-10-22-12-9-21-14-22/h7-9,12-14H,2-6,10-11H2,1H3 |
| InChIKey | FIYQMRUTYABPBV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|