C25H39BrO3 — CID 57390393
10-bromodecyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate (PubChem CID 57390393) has the molecular formula C25H39BrO3 and a molecular weight of 467.49 g/mol. Its IUPAC name is 10-bromodecyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate.
| Compound Name | 10-bromodecyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 57390393 |
| Molecular Formula | C25H39BrO3 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 10-bromodecyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCCCCCCCCCCBr)[C@@H]1CC[C@H](C)[C@@H]2CC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C25H39BrO3/c1-18-12-13-21(16-23-20(3)24(27)17-22(18)23)19(2)25(28)29-15-11-9-7-5-4-6-8-10-14-26/h18,21-22H,2,4-17H2,1,3H3/t18-,21+,22-/m0/s1 |
| InChIKey | SUZYHAUVKZPRRR-BWAGFHJFSA-N |
| XLogP | 6.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|