C35H46Cl2N8O6S — CID 57390466
2-[(5S)-5-amino-6-[4-[4-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]oxane-4-carbonyl]piperazin-1-yl]-6-oxohexyl]guanidine (PubChem CID 57390466) has the molecular formula C35H46Cl2N8O6S and a molecular weight of 777.78 g/mol. Its IUPAC name is 2-[(5S)-5-amino-6-[4-[4-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]oxane-4-carbonyl]piperazin-1-yl]-6-oxohexyl]guanidine.
| Compound Name | 2-[(5S)-5-amino-6-[4-[4-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]oxane-4-carbonyl]piperazin-1-yl]-6-oxohexyl]guanidine |
|---|---|
| PubChem CID | 57390466 |
| Molecular Formula | C35H46Cl2N8O6S |
| Molecular Weight | 777.78 g/mol |
| Exact Mass | 776.26 |
| IUPAC Name | 2-[(5S)-5-amino-6-[4-[4-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]oxane-4-carbonyl]piperazin-1-yl]-6-oxohexyl]guanidine |
| SMILES | Cc1cc(C)c2cccc(OCc3c(Cl)ccc(S(=O)(=O)NC4(C(=O)N5CCN(C(=O)[C@@H](N)CCCCN=C(N)N)CC5)CCOCC4)c3Cl)c2n1 |
| InChI | InChI=1S/C35H46Cl2N8O6S/c1-22-20-23(2)42-31-24(22)6-5-8-28(31)51-21-25-26(36)9-10-29(30(25)37)52(48,49)43-35(11-18-50-19-12-35)33(47)45-16-14-44(15-17-45)32(46)27(38)7-3-4-13-41-34(39)40/h5-6,8-10,20,27,43H,3-4,7,11-19,21,38H2,1-2H3,(H4,39,40,41)/t27-/m0/s1 |
| InChIKey | KUTHJKKCCLLPIU-MHZLTWQESA-N |
| XLogP | 3.01 |
| TPSA | 208.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|