C24H28N2O — CID 57390602
(6R,12bS)-12-benzyl-6-(methoxymethyl)-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine (PubChem CID 57390602) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is (6R,12bS)-12-benzyl-6-(methoxymethyl)-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine.
| Compound Name | (6R,12bS)-12-benzyl-6-(methoxymethyl)-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine |
|---|---|
| PubChem CID | 57390602 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (6R,12bS)-12-benzyl-6-(methoxymethyl)-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine |
| SMILES | COC[C@H]1Cc2c(n(Cc3ccccc3)c3ccccc23)[C@@H]2CCCCN12 |
| InChI | InChI=1S/C24H28N2O/c1-27-17-19-15-21-20-11-5-6-12-22(20)26(16-18-9-3-2-4-10-18)24(21)23-13-7-8-14-25(19)23/h2-6,9-12,19,23H,7-8,13-17H2,1H3/t19-,23+/m1/s1 |
| InChIKey | KRKQCUJQNIHMQM-XXBNENTESA-N |
| XLogP | 4.79 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|