C29H28O5 — CID 57390605
(1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(4-methoxyphenyl)penta-1,4-dien-3-one (PubChem CID 57390605) has the molecular formula C29H28O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(4-methoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(4-methoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 57390605 |
| Molecular Formula | C29H28O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(4-methoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(/C=C/C(=O)/C=C/c2c(/C=C/c3ccc(OC)cc3)cc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C29H28O5/c1-31-25-14-7-21(8-15-25)5-11-23-19-27(33-3)20-29(34-4)28(23)18-13-24(30)12-6-22-9-16-26(32-2)17-10-22/h5-20H,1-4H3/b11-5+,12-6+,18-13+ |
| InChIKey | HVKVQYQHKOELRK-NMTUHPLNSA-N |
| XLogP | 6.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|