C30H43NO2 — CID 57390613
1-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-3-(benzylamino)propan-2-ol (PubChem CID 57390613) has the molecular formula C30H43NO2 and a molecular weight of 449.68 g/mol. Its IUPAC name is 1-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-3-(benzylamino)propan-2-ol.
| Compound Name | 1-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-3-(benzylamino)propan-2-ol |
|---|---|
| PubChem CID | 57390613 |
| Molecular Formula | C30H43NO2 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.33 |
| IUPAC Name | 1-[[(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]oxy]-3-(benzylamino)propan-2-ol |
| SMILES | CC(C)c1c(OCC(O)CNCc2ccccc2)ccc2c1CC[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C30H43NO2/c1-21(2)28-24-12-15-27-29(3,4)16-9-17-30(27,5)25(24)13-14-26(28)33-20-23(32)19-31-18-22-10-7-6-8-11-22/h6-8,10-11,13-14,21,23,27,31-32H,9,12,15-20H2,1-5H3/t23?,27-,30+/m0/s1 |
| InChIKey | MWMMCUURYAJKBS-ZBAPEJEXSA-N |
| XLogP | 6.37 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |