C18H20N2O2 — CID 57390644
(2E,4E)-2-cyano-4-methyl-N-(oxolan-2-ylmethyl)-5-phenylpenta-2,4-dienamide (PubChem CID 57390644) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2E,4E)-2-cyano-4-methyl-N-(oxolan-2-ylmethyl)-5-phenylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-2-cyano-4-methyl-N-(oxolan-2-ylmethyl)-5-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 57390644 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2E,4E)-2-cyano-4-methyl-N-(oxolan-2-ylmethyl)-5-phenylpenta-2,4-dienamide |
| SMILES | CC(=C\c1ccccc1)/C=C(\C#N)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C18H20N2O2/c1-14(10-15-6-3-2-4-7-15)11-16(12-19)18(21)20-13-17-8-5-9-22-17/h2-4,6-7,10-11,17H,5,8-9,13H2,1H3,(H,20,21)/b14-10+,16-11+ |
| InChIKey | SRJRSBQMGHEKQY-LRHSVYTJSA-N |
| XLogP | 2.84 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|