C23H25N7O — CID 57390672
7-(6-methoxy-3-pyridinyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 57390672) has the molecular formula C23H25N7O and a molecular weight of 415.50 g/mol. Its IUPAC name is 7-(6-methoxy-3-pyridinyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-(6-methoxy-3-pyridinyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 57390672 |
| Molecular Formula | C23H25N7O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 7-(6-methoxy-3-pyridinyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1ccc(-c2ccc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nn23)cn1 |
| InChI | InChI=1S/C23H25N7O/c1-28-11-13-29(14-12-28)19-6-4-18(5-7-19)26-23-25-16-20-8-9-21(30(20)27-23)17-3-10-22(31-2)24-15-17/h3-10,15-16H,11-14H2,1-2H3,(H,26,27) |
| InChIKey | AUBMHGIYZLILEO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|