C32H31N2S+ — CID 57390751
4-[(E)-2-(6,7-dibenzyl-3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 57390751) has the molecular formula C32H31N2S+ and a molecular weight of 475.68 g/mol. Its IUPAC name is 4-[(E)-2-(6,7-dibenzyl-3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(6,7-dibenzyl-3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 57390751 |
| Molecular Formula | C32H31N2S+ |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 4-[(E)-2-(6,7-dibenzyl-3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2sc3c(Cc4ccccc4)c(Cc4ccccc4)ccc3[n+]2C)cc1 |
| InChI | InChI=1S/C32H31N2S/c1-33(2)28-18-14-24(15-19-28)16-21-31-34(3)30-20-17-27(22-25-10-6-4-7-11-25)29(32(30)35-31)23-26-12-8-5-9-13-26/h4-21H,22-23H2,1-3H3/q+1 |
| InChIKey | RQNJBCVNXANMJX-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|