About 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one
5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one (PubChem CID 57390865) has the molecular formula C15H9NO3S
and a molecular weight of 283.31 g/mol. Its IUPAC name is 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one |
| PubChem CID | 57390865 |
| Molecular Formula | C15H9NO3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one |
| SMILES | O=C1OCc2cc(-c3ccc(-c4cnco4)s3)ccc21 |
| InChI | InChI=1S/C15H9NO3S/c17-15-11-2-1-9(5-10(11)7-18-15)13-3-4-14(20-13)12-6-16-8-19-12/h1-6,8H,7H2 |
| InChIKey | ZZLZQMTZPMJUAW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one?
The IUPAC name of 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one (CID 57390865) is 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one.
What is the SMILES notation for 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one?
The canonical SMILES for 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one is O=C1OCc2cc(-c3ccc(-c4cnco4)s3)ccc21.
What is the InChIKey of 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one?
The InChIKey is ZZLZQMTZPMJUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9NO3S/c17-15-11-2-1-9(5-10(11)7-18-15)13-3-4-14(20-13)12-6-16-8-19-12/h1-6,8H,7H2.
What are the key properties of 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one?
5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one has a molecular weight of 283.31 g/mol, XLogP of 3.74, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(1,3-oxazol-5-yl)thiophen-2-yl]-3H-2-benzofuran-1-one is sourced from PubChem (CID 57390865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).