C24H19N5O4 — CID 57391047
[3-(10-morpholin-4-yl-1,6,11,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-12-yl)phenyl] furan-2-carboxylate (PubChem CID 57391047) has the molecular formula C24H19N5O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is [3-(10-morpholin-4-yl-1,6,11,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-12-yl)phenyl] furan-2-carboxylate.
| Compound Name | [3-(10-morpholin-4-yl-1,6,11,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-12-yl)phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 57391047 |
| Molecular Formula | C24H19N5O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [3-(10-morpholin-4-yl-1,6,11,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-12-yl)phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1cccc(-c2nc(N3CCOCC3)c3cc4ncccc4n3n2)c1)c1ccco1 |
| InChI | InChI=1S/C24H19N5O4/c30-24(21-7-3-11-32-21)33-17-5-1-4-16(14-17)22-26-23(28-9-12-31-13-10-28)20-15-18-19(29(20)27-22)6-2-8-25-18/h1-8,11,14-15H,9-10,12-13H2 |
| InChIKey | XRIKRFPDDQJDEV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 94.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|