About 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide
2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 57391179) has the molecular formula C21H19FN6O3
and a molecular weight of 422.42 g/mol. Its IUPAC name is 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide.
Molecular Properties
| Compound Name | 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide |
| PubChem CID | 57391179 |
| Molecular Formula | C21H19FN6O3 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | COc1cc2ncnc(Nc3cnn(CC(=O)Nc4cccc(F)c4)c3)c2cc1OC |
| InChI | InChI=1S/C21H19FN6O3/c1-30-18-7-16-17(8-19(18)31-2)23-12-24-21(16)27-15-9-25-28(10-15)11-20(29)26-14-5-3-4-13(22)6-14/h3-10,12H,11H2,1-2H3,(H,26,29)(H,23,24,27) |
| InChIKey | NGBFROQDGZCMCE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide?
The IUPAC name of 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide (CID 57391179) is 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide.
What is the SMILES notation for 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide?
The canonical SMILES for 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide is COc1cc2ncnc(Nc3cnn(CC(=O)Nc4cccc(F)c4)c3)c2cc1OC.
What is the InChIKey of 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide?
The InChIKey is NGBFROQDGZCMCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN6O3/c1-30-18-7-16-17(8-19(18)31-2)23-12-24-21(16)27-15-9-25-28(10-15)11-20(29)26-14-5-3-4-13(22)6-14/h3-10,12H,11H2,1-2H3,(H,26,29)(H,23,24,27).
What are the key properties of 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide?
2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide has a molecular weight of 422.42 g/mol, XLogP of 3.36, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide is sourced from PubChem (CID 57391179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).