About N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine
N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 57391268) has the molecular formula C16H15F3N4O
and a molecular weight of 336.32 g/mol. Its IUPAC name is N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine |
| PubChem CID | 57391268 |
| Molecular Formula | C16H15F3N4O |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | CCCNc1ccc2ncc(-c3cccc(OC(F)(F)F)c3)n2n1 |
| InChI | InChI=1S/C16H15F3N4O/c1-2-8-20-14-6-7-15-21-10-13(23(15)22-14)11-4-3-5-12(9-11)24-16(17,18)19/h3-7,9-10H,2,8H2,1H3,(H,20,22) |
| InChIKey | IDPCKTWXIMZSMZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine?
The IUPAC name of N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine (CID 57391268) is N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine.
What is the SMILES notation for N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine?
The canonical SMILES for N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine is CCCNc1ccc2ncc(-c3cccc(OC(F)(F)F)c3)n2n1.
What is the InChIKey of N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine?
The InChIKey is IDPCKTWXIMZSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F3N4O/c1-2-8-20-14-6-7-15-21-10-13(23(15)22-14)11-4-3-5-12(9-11)24-16(17,18)19/h3-7,9-10H,2,8H2,1H3,(H,20,22).
What are the key properties of N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine?
N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine has a molecular weight of 336.32 g/mol, XLogP of 4.12, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-3-[3-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazin-6-amine is sourced from PubChem (CID 57391268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).