C34H31N5O3 — CID 57391323
5-(4-cyanophenyl)-N-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-N-(4-piperazin-1-ylphenyl)furan-2-carboxamide (PubChem CID 57391323) has the molecular formula C34H31N5O3 and a molecular weight of 557.65 g/mol. Its IUPAC name is 5-(4-cyanophenyl)-N-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-N-(4-piperazin-1-ylphenyl)furan-2-carboxamide.
| Compound Name | 5-(4-cyanophenyl)-N-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-N-(4-piperazin-1-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 57391323 |
| Molecular Formula | C34H31N5O3 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 5-(4-cyanophenyl)-N-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-N-(4-piperazin-1-ylphenyl)furan-2-carboxamide |
| SMILES | Cc1noc(C)c1-c1ccccc1CN(C(=O)c1ccc(-c2ccc(C#N)cc2)o1)c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C34H31N5O3/c1-23-33(24(2)42-37-23)30-6-4-3-5-27(30)22-39(29-13-11-28(12-14-29)38-19-17-36-18-20-38)34(40)32-16-15-31(41-32)26-9-7-25(21-35)8-10-26/h3-16,36H,17-20,22H2,1-2H3 |
| InChIKey | AKSBJSCHRGVNRM-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|