C19H21N7O — CID 57391445
N-[1-[6-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-2-pyridinyl]ethyl]acetamide (PubChem CID 57391445) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is N-[1-[6-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-2-pyridinyl]ethyl]acetamide.
| Compound Name | N-[1-[6-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-2-pyridinyl]ethyl]acetamide |
|---|---|
| PubChem CID | 57391445 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-[1-[6-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-2-pyridinyl]ethyl]acetamide |
| SMILES | CNc1nc2[nH]c(-c3cccc(C(C)NC(C)=O)n3)cc2c2c1ncn2C |
| InChI | InChI=1S/C19H21N7O/c1-10(22-11(2)27)13-6-5-7-14(23-13)15-8-12-17-16(21-9-26(17)4)19(20-3)25-18(12)24-15/h5-10H,1-4H3,(H,22,27)(H2,20,24,25) |
| InChIKey | HJNOHXBEFNKEHY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |