C18H21N7O — CID 57391448
11-[6-(2-methoxyethylamino)-2-pyridinyl]-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine (PubChem CID 57391448) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is 11-[6-(2-methoxyethylamino)-2-pyridinyl]-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine.
| Compound Name | 11-[6-(2-methoxyethylamino)-2-pyridinyl]-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine |
|---|---|
| PubChem CID | 57391448 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 11-[6-(2-methoxyethylamino)-2-pyridinyl]-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine |
| SMILES | CNc1nc2[nH]c(-c3cccc(NCCOC)n3)cc2c2c1ncn2C |
| InChI | InChI=1S/C18H21N7O/c1-19-18-15-16(25(2)10-21-15)11-9-13(23-17(11)24-18)12-5-4-6-14(22-12)20-7-8-26-3/h4-6,9-10H,7-8H2,1-3H3,(H,20,22)(H2,19,23,24) |
| InChIKey | XCDWXTLIYQVDDO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|