C27H34FN3O6S2 — CID 57391494
4-fluoro-N-[(9R,12S,15S)-9-formyl-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]benzenesulfonamide (PubChem CID 57391494) has the molecular formula C27H34FN3O6S2 and a molecular weight of 579.72 g/mol. Its IUPAC name is 4-fluoro-N-[(9R,12S,15S)-9-formyl-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[(9R,12S,15S)-9-formyl-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57391494 |
| Molecular Formula | C27H34FN3O6S2 |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 4-fluoro-N-[(9R,12S,15S)-9-formyl-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]benzenesulfonamide |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](NS(=O)(=O)c2ccc(F)cc2)Cc2ccc(cc2)OCCCCSC[C@@H](C=O)NC1=O |
| InChI | InChI=1S/C27H34FN3O6S2/c1-18(2)25-27(34)29-21(16-32)17-38-14-4-3-13-37-22-9-5-19(6-10-22)15-24(26(33)30-25)31-39(35,36)23-11-7-20(28)8-12-23/h5-12,16,18,21,24-25,31H,3-4,13-15,17H2,1-2H3,(H,29,34)(H,30,33)/t21-,24+,25+/m1/s1 |
| InChIKey | NKOTVYQMDQLCLO-ZODMCCGTSA-N |
| XLogP | 2.45 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|