C19H18O5 — CID 57391532
(1R,12S)-6,6-dimethyl-5,7,14-trioxapentacyclo[10.8.0.02,10.04,8.015,20]icosa-2,4(8),9,15(20),16,18-hexaene-12,16-diol (PubChem CID 57391532) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (1R,12S)-6,6-dimethyl-5,7,14-trioxapentacyclo[10.8.0.02,10.04,8.015,20]icosa-2,4(8),9,15(20),16,18-hexaene-12,16-diol.
| Compound Name | (1R,12S)-6,6-dimethyl-5,7,14-trioxapentacyclo[10.8.0.02,10.04,8.015,20]icosa-2,4(8),9,15(20),16,18-hexaene-12,16-diol |
|---|---|
| PubChem CID | 57391532 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (1R,12S)-6,6-dimethyl-5,7,14-trioxapentacyclo[10.8.0.02,10.04,8.015,20]icosa-2,4(8),9,15(20),16,18-hexaene-12,16-diol |
| SMILES | CC1(C)Oc2cc3c(cc2O1)[C@@H]1c2cccc(O)c2OC[C@]1(O)C3 |
| InChI | InChI=1S/C19H18O5/c1-18(2)23-14-6-10-8-19(21)9-22-17-11(4-3-5-13(17)20)16(19)12(10)7-15(14)24-18/h3-7,16,20-21H,8-9H2,1-2H3/t16-,19+/m0/s1 |
| InChIKey | CZFXDTRQSTZYAV-QFBILLFUSA-N |
| XLogP | 2.71 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |