C18H24N2 — CID 57391572
2,9,11-trimethyl-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole (PubChem CID 57391572) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2,9,11-trimethyl-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole.
| Compound Name | 2,9,11-trimethyl-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 57391572 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2,9,11-trimethyl-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
| SMILES | Cc1ccc2[nH]c3c(c2c1)C(C)C1CN(C)CCC1C3 |
| InChI | InChI=1S/C18H24N2/c1-11-4-5-16-14(8-11)18-12(2)15-10-20(3)7-6-13(15)9-17(18)19-16/h4-5,8,12-13,15,19H,6-7,9-10H2,1-3H3 |
| InChIKey | WWOFBJFAEQLWSA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|