C25H27F3N2 — CID 57391574
11-methyl-2-(2-phenylethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole (PubChem CID 57391574) has the molecular formula C25H27F3N2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 11-methyl-2-(2-phenylethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole.
| Compound Name | 11-methyl-2-(2-phenylethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 57391574 |
| Molecular Formula | C25H27F3N2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 11-methyl-2-(2-phenylethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
| SMILES | CC1c2c([nH]c3ccc(C(F)(F)F)cc23)CC2CCN(CCc3ccccc3)CC21 |
| InChI | InChI=1S/C25H27F3N2/c1-16-21-15-30(11-9-17-5-3-2-4-6-17)12-10-18(21)13-23-24(16)20-14-19(25(26,27)28)7-8-22(20)29-23/h2-8,14,16,18,21,29H,9-13,15H2,1H3 |
| InChIKey | MEFBNOXISJBUAP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|