C22H25F3N2O2 — CID 57391575
[11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]-(oxolan-3-yl)methanone (PubChem CID 57391575) has the molecular formula C22H25F3N2O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is [11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]-(oxolan-3-yl)methanone.
| Compound Name | [11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]-(oxolan-3-yl)methanone |
|---|---|
| PubChem CID | 57391575 |
| Molecular Formula | C22H25F3N2O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]-(oxolan-3-yl)methanone |
| SMILES | CC1c2c([nH]c3ccc(C(F)(F)F)cc23)CC2CCN(C(=O)C3CCOC3)CC21 |
| InChI | InChI=1S/C22H25F3N2O2/c1-12-17-10-27(21(28)14-5-7-29-11-14)6-4-13(17)8-19-20(12)16-9-15(22(23,24)25)2-3-18(16)26-19/h2-3,9,12-14,17,26H,4-8,10-11H2,1H3 |
| InChIKey | KCGXXRBMPRXFSA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|