About (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine
(2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine (PubChem CID 57391582) has the molecular formula C17H21NO2
and a molecular weight of 271.36 g/mol. Its IUPAC name is (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine.
Molecular Properties
| Compound Name | (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine |
| PubChem CID | 57391582 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine |
| SMILES | COCO[C@@H](c1ccccc1)[C@@H](CN)c1ccccc1 |
| InChI | InChI=1S/C17H21NO2/c1-19-13-20-17(15-10-6-3-7-11-15)16(12-18)14-8-4-2-5-9-14/h2-11,16-17H,12-13,18H2,1H3/t16-,17-/m0/s1 |
| InChIKey | XNTPDGPNLLYSDT-IRXDYDNUSA-N |
| XLogP | 3.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine?
The IUPAC name of (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine (CID 57391582) is (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine.
What is the SMILES notation for (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine?
The canonical SMILES for (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine is COCO[C@@H](c1ccccc1)[C@@H](CN)c1ccccc1.
What is the InChIKey of (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine?
The InChIKey is XNTPDGPNLLYSDT-IRXDYDNUSA-N. The full InChI is InChI=1S/C17H21NO2/c1-19-13-20-17(15-10-6-3-7-11-15)16(12-18)14-8-4-2-5-9-14/h2-11,16-17H,12-13,18H2,1H3/t16-,17-/m0/s1.
What are the key properties of (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine?
(2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine has a molecular weight of 271.36 g/mol, XLogP of 3.09, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-(methoxymethoxy)-2,3-diphenylpropan-1-amine is sourced from PubChem (CID 57391582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).