C23H28NO2+ — CID 57391663
[(1R,5S)-8-methyl-8-(2-phenylethyl)-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate (PubChem CID 57391663) has the molecular formula C23H28NO2+ and a molecular weight of 350.48 g/mol. Its IUPAC name is [(1R,5S)-8-methyl-8-(2-phenylethyl)-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate.
| Compound Name | [(1R,5S)-8-methyl-8-(2-phenylethyl)-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate |
|---|---|
| PubChem CID | 57391663 |
| Molecular Formula | C23H28NO2+ |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [(1R,5S)-8-methyl-8-(2-phenylethyl)-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate |
| SMILES | C[N+]1(CCc2ccccc2)[C@@H]2CC[C@H]1CC(OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C23H28NO2/c1-24(15-14-18-8-4-2-5-9-18)20-12-13-21(24)17-22(16-20)26-23(25)19-10-6-3-7-11-19/h2-11,20-22H,12-17H2,1H3/q+1/t20-,21+,22?,24? |
| InChIKey | SKNRIMBFFBIGKY-FPCVHMJOSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|