C18H15N7O — CID 57391694
11-(furan-2-yl)-3-(2-phenylethyl)-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaen-8-amine (PubChem CID 57391694) has the molecular formula C18H15N7O and a molecular weight of 345.37 g/mol. Its IUPAC name is 11-(furan-2-yl)-3-(2-phenylethyl)-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaen-8-amine.
| Compound Name | 11-(furan-2-yl)-3-(2-phenylethyl)-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 57391694 |
| Molecular Formula | C18H15N7O |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 11-(furan-2-yl)-3-(2-phenylethyl)-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaen-8-amine |
| SMILES | Nc1nc2cnn(CCc3ccccc3)c2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C18H15N7O/c19-18-21-13-11-20-24(9-8-12-5-2-1-3-6-12)15(13)17-22-16(23-25(17)18)14-7-4-10-26-14/h1-7,10-11H,8-9H2,(H2,19,21) |
| InChIKey | SLRFMWZADWPTCV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |