C15H15N7O2 — CID 57391696
4-[11-(furan-2-yl)-3-methyl-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaen-8-yl]morpholine (PubChem CID 57391696) has the molecular formula C15H15N7O2 and a molecular weight of 325.33 g/mol. Its IUPAC name is 4-[11-(furan-2-yl)-3-methyl-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaen-8-yl]morpholine.
| Compound Name | 4-[11-(furan-2-yl)-3-methyl-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaen-8-yl]morpholine |
|---|---|
| PubChem CID | 57391696 |
| Molecular Formula | C15H15N7O2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-[11-(furan-2-yl)-3-methyl-3,4,7,9,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,7,10-pentaen-8-yl]morpholine |
| SMILES | Cn1ncc2nc(N3CCOCC3)n3nc(-c4ccco4)nc3c21 |
| InChI | InChI=1S/C15H15N7O2/c1-20-12-10(9-16-20)17-15(21-4-7-23-8-5-21)22-14(12)18-13(19-22)11-3-2-6-24-11/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | IBTVWJBTRQGRMW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |