C19H23F2NO2 — CID 57391710
methyl (1R,2S,3S,5S)-8-[(E)-4-fluorobut-2-enyl]-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 57391710) has the molecular formula C19H23F2NO2 and a molecular weight of 335.39 g/mol. Its IUPAC name is methyl (1R,2S,3S,5S)-8-[(E)-4-fluorobut-2-enyl]-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2S,3S,5S)-8-[(E)-4-fluorobut-2-enyl]-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 57391710 |
| Molecular Formula | C19H23F2NO2 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | methyl (1R,2S,3S,5S)-8-[(E)-4-fluorobut-2-enyl]-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](c2ccc(F)cc2)C[C@@H]2CC[C@H]1N2C/C=C/CF |
| InChI | InChI=1S/C19H23F2NO2/c1-24-19(23)18-16(13-4-6-14(21)7-5-13)12-15-8-9-17(18)22(15)11-3-2-10-20/h2-7,15-18H,8-12H2,1H3/b3-2+/t15-,16+,17+,18-/m0/s1 |
| InChIKey | SGCXLJVGGMOGGK-MBHMRJJTSA-N |
| XLogP | 3.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|