C14H12F2N2O4 — CID 57391735
3-[2-(2,4-difluorophenoxy)ethoxy]-6-methyl-2-nitropyridine (PubChem CID 57391735) has the molecular formula C14H12F2N2O4 and a molecular weight of 310.26 g/mol. Its IUPAC name is 3-[2-(2,4-difluorophenoxy)ethoxy]-6-methyl-2-nitropyridine.
| Compound Name | 3-[2-(2,4-difluorophenoxy)ethoxy]-6-methyl-2-nitropyridine |
|---|---|
| PubChem CID | 57391735 |
| Molecular Formula | C14H12F2N2O4 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-[2-(2,4-difluorophenoxy)ethoxy]-6-methyl-2-nitropyridine |
| SMILES | Cc1ccc(OCCOc2ccc(F)cc2F)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H12F2N2O4/c1-9-2-4-13(14(17-9)18(19)20)22-7-6-21-12-5-3-10(15)8-11(12)16/h2-5,8H,6-7H2,1H3 |
| InChIKey | POEQMHCHXYKNGO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|