C24H28F3N5O3 — CID 57391768
N-[2-[[(3R)-1-(4-hydroxy-4-pyrimidin-4-ylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 57391768) has the molecular formula C24H28F3N5O3 and a molecular weight of 491.51 g/mol. Its IUPAC name is N-[2-[[(3R)-1-(4-hydroxy-4-pyrimidin-4-ylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(3R)-1-(4-hydroxy-4-pyrimidin-4-ylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 57391768 |
| Molecular Formula | C24H28F3N5O3 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-[2-[[(3R)-1-(4-hydroxy-4-pyrimidin-4-ylcyclohexyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1cccc(C(F)(F)F)c1)N[C@@H]1CCN(C2CCC(O)(c3ccncn3)CC2)C1 |
| InChI | InChI=1S/C24H28F3N5O3/c25-24(26,27)17-3-1-2-16(12-17)22(34)29-13-21(33)31-18-7-11-32(14-18)19-4-8-23(35,9-5-19)20-6-10-28-15-30-20/h1-3,6,10,12,15,18-19,35H,4-5,7-9,11,13-14H2,(H,29,34)(H,31,33)/t18-,19?,23?/m1/s1 |
| InChIKey | YAFRFZRHFCETGN-MVBMGLOESA-N |
| XLogP | 2.25 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |