C18H17NO4 — CID 57391818
ethyl 2,3,7-trimethyl-1,4-dioxopyrido[1,2-a]indole-10-carboxylate (PubChem CID 57391818) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is ethyl 2,3,7-trimethyl-1,4-dioxopyrido[1,2-a]indole-10-carboxylate.
| Compound Name | ethyl 2,3,7-trimethyl-1,4-dioxopyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 57391818 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | ethyl 2,3,7-trimethyl-1,4-dioxopyrido[1,2-a]indole-10-carboxylate |
| SMILES | CCOC(=O)c1c2c(n3cc(C)ccc13)C(=O)C(C)=C(C)C2=O |
| InChI | InChI=1S/C18H17NO4/c1-5-23-18(22)13-12-7-6-9(2)8-19(12)15-14(13)16(20)10(3)11(4)17(15)21/h6-8H,5H2,1-4H3 |
| InChIKey | OQJGPFPPWAMVDF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|