About 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide
4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide (PubChem CID 57391848) has the molecular formula C15H17N5O2S
and a molecular weight of 331.40 g/mol. Its IUPAC name is 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| PubChem CID | 57391848 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| SMILES | Cc1nn(C)c(C)c1NS(=O)(=O)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C15H17N5O2S/c1-11-15(12(2)19(3)17-11)18-23(21,22)14-7-5-13(6-8-14)20-10-4-9-16-20/h4-10,18H,1-3H3 |
| InChIKey | OGRPBGATTQEJAA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
The IUPAC name of 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide (CID 57391848) is 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide.
What is the SMILES notation for 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
The canonical SMILES for 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide is Cc1nn(C)c(C)c1NS(=O)(=O)c1ccc(-n2cccn2)cc1.
What is the InChIKey of 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
The InChIKey is OGRPBGATTQEJAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O2S/c1-11-15(12(2)19(3)17-11)18-23(21,22)14-7-5-13(6-8-14)20-10-4-9-16-20/h4-10,18H,1-3H3.
What are the key properties of 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide has a molecular weight of 331.40 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrazol-1-yl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide is sourced from PubChem (CID 57391848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).