About [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine
[4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine (PubChem CID 57391918) has the molecular formula C15H17N5O
and a molecular weight of 283.33 g/mol. Its IUPAC name is [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine |
| PubChem CID | 57391918 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine |
| SMILES | NCC1CN(c2ncnc3[nH]c4ccccc4c23)CCO1 |
| InChI | InChI=1S/C15H17N5O/c16-7-10-8-20(5-6-21-10)15-13-11-3-1-2-4-12(11)19-14(13)17-9-18-15/h1-4,9-10H,5-8,16H2,(H,17,18,19) |
| InChIKey | YHCVVHVXQWXBAU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine?
The IUPAC name of [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine (CID 57391918) is [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine.
What is the SMILES notation for [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine?
The canonical SMILES for [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine is NCC1CN(c2ncnc3[nH]c4ccccc4c23)CCO1.
What is the InChIKey of [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine?
The InChIKey is YHCVVHVXQWXBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O/c16-7-10-8-20(5-6-21-10)15-13-11-3-1-2-4-12(11)19-14(13)17-9-18-15/h1-4,9-10H,5-8,16H2,(H,17,18,19).
What are the key properties of [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine?
[4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine has a molecular weight of 283.33 g/mol, XLogP of 1.27, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(9H-pyrimido[4,5-b]indol-4-yl)morpholin-2-yl]methanamine is sourced from PubChem (CID 57391918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).