C14H16N6O — CID 57391919
[4-(4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-3-yl)morpholin-2-yl]methanamine (PubChem CID 57391919) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is [4-(4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-3-yl)morpholin-2-yl]methanamine.
| Compound Name | [4-(4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-3-yl)morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 57391919 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [4-(4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-3-yl)morpholin-2-yl]methanamine |
| SMILES | NCC1CN(c2ncnc3[nH]c4cnccc4c23)CCO1 |
| InChI | InChI=1S/C14H16N6O/c15-5-9-7-20(3-4-21-9)14-12-10-1-2-16-6-11(10)19-13(12)17-8-18-14/h1-2,6,8-9H,3-5,7,15H2,(H,17,18,19) |
| InChIKey | ZOMFTMSIQWYIQV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |