C15H18N4O — CID 57391926
[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-benzimidazol-2-yl)methanone (PubChem CID 57391926) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is [(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-benzimidazol-2-yl)methanone.
| Compound Name | [(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-benzimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 57391926 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-benzimidazol-2-yl)methanone |
| SMILES | CN1C[C@@H]2CN(C(=O)c3nc4ccccc4[nH]3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H18N4O/c1-18-6-10-8-19(9-11(10)7-18)15(20)14-16-12-4-2-3-5-13(12)17-14/h2-5,10-11H,6-9H2,1H3,(H,16,17)/t10-,11+ |
| InChIKey | LXVXLEBCNVNKBY-PHIMTYICSA-N |
| XLogP | 1.20 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |