C33H50O4 — CID 57392043
methyl (2R,7S,10R,20S)-7-acetyloxy-2,6,6,10,17,17-hexamethyl-14-methylidenepentacyclo[11.9.0.02,11.05,10.015,20]docos-1(22)-ene-20-carboxylate (PubChem CID 57392043) has the molecular formula C33H50O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is methyl (2R,7S,10R,20S)-7-acetyloxy-2,6,6,10,17,17-hexamethyl-14-methylidenepentacyclo[11.9.0.02,11.05,10.015,20]docos-1(22)-ene-20-carboxylate.
| Compound Name | methyl (2R,7S,10R,20S)-7-acetyloxy-2,6,6,10,17,17-hexamethyl-14-methylidenepentacyclo[11.9.0.02,11.05,10.015,20]docos-1(22)-ene-20-carboxylate |
|---|---|
| PubChem CID | 57392043 |
| Molecular Formula | C33H50O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | methyl (2R,7S,10R,20S)-7-acetyloxy-2,6,6,10,17,17-hexamethyl-14-methylidenepentacyclo[11.9.0.02,11.05,10.015,20]docos-1(22)-ene-20-carboxylate |
| SMILES | C=C1C2CC3[C@@]4(C)CC[C@H](OC(C)=O)C(C)(C)C4CC[C@@]3(C)C2=CC[C@@]2(C(=O)OC)CCC(C)(C)CC12 |
| InChI | InChI=1S/C33H50O4/c1-20-22-18-26-31(7,13-11-25-30(5,6)27(37-21(2)34)12-14-32(25,26)8)23(22)10-15-33(28(35)36-9)17-16-29(3,4)19-24(20)33/h10,22,24-27H,1,11-19H2,2-9H3/t22?,24?,25?,26?,27-,31-,32-,33+/m0/s1 |
| InChIKey | BWFQDJHFKDFSOB-UXLAYUOMSA-N |
| XLogP | 7.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|