C23H31F2NO4 — CID 57392193
ethyl 7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 57392193) has the molecular formula C23H31F2NO4 and a molecular weight of 423.50 g/mol. Its IUPAC name is ethyl 7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | ethyl 7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 57392193 |
| Molecular Formula | C23H31F2NO4 |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | ethyl 7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1C(=O)CC[C@@H]1/C=C/[C@@H](O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C23H31F2NO4/c1-2-30-22(29)12-8-3-4-9-17-26-19(14-16-21(26)28)13-15-20(27)23(24,25)18-10-6-5-7-11-18/h5-7,10-11,13,15,19-20,27H,2-4,8-9,12,14,16-17H2,1H3/b15-13+/t19-,20+/m0/s1 |
| InChIKey | SGRNLJLJXBPJCJ-VIDFKJSCSA-N |
| XLogP | 4.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|