About CID 57392363
CID 57392363 (PubChem CID 57392363) has the molecular formula C31H29ClN2O6S
and a molecular weight of 593.10 g/mol.
Molecular Properties
| Compound Name | CID 57392363 |
| PubChem CID | 57392363 |
| Molecular Formula | C31H29ClN2O6S |
| Molecular Weight | 593.10 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | — |
| SMILES | COc1ccc(C2C3CSCN3C3(C(=O)Nc4ccc(Cl)cc43)C23Cc2cc(OC)c(OC)cc2C3=O)cc1OC |
| InChI | InChI=1S/C31H29ClN2O6S/c1-37-23-8-5-16(9-24(23)38-2)27-22-14-41-15-34(22)31(20-11-18(32)6-7-21(20)33-29(31)36)30(27)13-17-10-25(39-3)26(40-4)12-19(17)28(30)35/h5-12,22,27H,13-15H2,1-4H3,(H,33,36) |
| InChIKey | KKHDCFIRNGTLJP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 593.10 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 57392363 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57392363?
The IUPAC name of CID 57392363 (CID 57392363) is not available.
What is the SMILES notation for CID 57392363?
The canonical SMILES for CID 57392363 is COc1ccc(C2C3CSCN3C3(C(=O)Nc4ccc(Cl)cc43)C23Cc2cc(OC)c(OC)cc2C3=O)cc1OC.
What is the InChIKey of CID 57392363?
The InChIKey is KKHDCFIRNGTLJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H29ClN2O6S/c1-37-23-8-5-16(9-24(23)38-2)27-22-14-41-15-34(22)31(20-11-18(32)6-7-21(20)33-29(31)36)30(27)13-17-10-25(39-3)26(40-4)12-19(17)28(30)35/h5-12,22,27H,13-15H2,1-4H3,(H,33,36).
What are the key properties of CID 57392363?
CID 57392363 has a molecular weight of 593.10 g/mol, XLogP of 5.12, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57392363 is sourced from PubChem (CID 57392363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).