C30H30N2O2 — CID 57392373
(6R,12bS)-12-benzyl-6-(phenylmethoxymethyl)-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one (PubChem CID 57392373) has the molecular formula C30H30N2O2 and a molecular weight of 450.58 g/mol. Its IUPAC name is (6R,12bS)-12-benzyl-6-(phenylmethoxymethyl)-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one.
| Compound Name | (6R,12bS)-12-benzyl-6-(phenylmethoxymethyl)-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 57392373 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (6R,12bS)-12-benzyl-6-(phenylmethoxymethyl)-1,2,3,6,7,12b-hexahydroindolo[2,3-a]quinolizin-4-one |
| SMILES | O=C1CCC[C@H]2c3c(c4ccccc4n3Cc3ccccc3)C[C@H](COCc3ccccc3)N12 |
| InChI | InChI=1S/C30H30N2O2/c33-29-17-9-16-28-30-26(18-24(32(28)29)21-34-20-23-12-5-2-6-13-23)25-14-7-8-15-27(25)31(30)19-22-10-3-1-4-11-22/h1-8,10-15,24,28H,9,16-21H2/t24-,28+/m1/s1 |
| InChIKey | JMZHXWGHOOYLAI-YWEHKCAJSA-N |
| XLogP | 5.88 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|