C23H23N5O2 — CID 57392473
7-(2-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 57392473) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 7-(2-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-(2-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 57392473 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 7-(2-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1ccccc1-c1ccc2cnc(Nc3ccc(N4CCOCC4)cc3)nn12 |
| InChI | InChI=1S/C23H23N5O2/c1-29-22-5-3-2-4-20(22)21-11-10-19-16-24-23(26-28(19)21)25-17-6-8-18(9-7-17)27-12-14-30-15-13-27/h2-11,16H,12-15H2,1H3,(H,25,26) |
| InChIKey | WGISNQGRTXXQPY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|