C26H29FN6O2 — CID 57392475
(2S)-1-[4-[2-fluoro-4-[[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol (PubChem CID 57392475) has the molecular formula C26H29FN6O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is (2S)-1-[4-[2-fluoro-4-[[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[4-[2-fluoro-4-[[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 57392475 |
| Molecular Formula | C26H29FN6O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (2S)-1-[4-[2-fluoro-4-[[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperazin-1-yl]propan-2-ol |
| SMILES | COc1ccccc1-c1ccc2cnc(Nc3ccc(N4CCN(C[C@H](C)O)CC4)c(F)c3)nn12 |
| InChI | InChI=1S/C26H29FN6O2/c1-18(34)17-31-11-13-32(14-12-31)24-9-7-19(15-22(24)27)29-26-28-16-20-8-10-23(33(20)30-26)21-5-3-4-6-25(21)35-2/h3-10,15-16,18,34H,11-14,17H2,1-2H3,(H,29,30)/t18-/m0/s1 |
| InChIKey | MBYILQJHVBMZBA-SFHVURJKSA-N |
| XLogP | 3.79 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|