C29H34Cl2N2O5 — CID 57392656
[1-[5-(3,4-dichlorophenoxy)pentyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 57392656) has the molecular formula C29H34Cl2N2O5 and a molecular weight of 561.51 g/mol. Its IUPAC name is [1-[5-(3,4-dichlorophenoxy)pentyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [1-[5-(3,4-dichlorophenoxy)pentyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 57392656 |
| Molecular Formula | C29H34Cl2N2O5 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | [1-[5-(3,4-dichlorophenoxy)pentyl]piperidin-3-yl]methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CC1CC(=O)N(c2ccccc2C(=O)OCC2CCCN(CCCCCOc3ccc(Cl)c(Cl)c3)C2)C1=O |
| InChI | InChI=1S/C29H34Cl2N2O5/c1-20-16-27(34)33(28(20)35)26-10-4-3-9-23(26)29(36)38-19-21-8-7-14-32(18-21)13-5-2-6-15-37-22-11-12-24(30)25(31)17-22/h3-4,9-12,17,20-21H,2,5-8,13-16,18-19H2,1H3 |
| InChIKey | GJLNDEKDUVZOPE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|