About 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride
3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride (PubChem CID 57392713) has the molecular formula C20H26ClN3O2
and a molecular weight of 375.90 g/mol. Its IUPAC name is 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride.
Molecular Properties
| Compound Name | 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride |
| PubChem CID | 57392713 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride |
| SMILES | CCCCCCCCCn1n[n+](C)c2c1C(=O)c1ccccc1C2=O.[Cl-] |
| InChI | InChI=1S/C20H26N3O2.ClH/c1-3-4-5-6-7-8-11-14-23-18-17(22(2)21-23)19(24)15-12-9-10-13-16(15)20(18)25;/h9-10,12-13H,3-8,11,14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PTRKYPLLCBXCPO-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride?
The IUPAC name of 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride (CID 57392713) is 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride.
What is the SMILES notation for 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride?
The canonical SMILES for 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride is CCCCCCCCCn1n[n+](C)c2c1C(=O)c1ccccc1C2=O.[Cl-].
What is the InChIKey of 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride?
The InChIKey is PTRKYPLLCBXCPO-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H26N3O2.ClH/c1-3-4-5-6-7-8-11-14-23-18-17(22(2)21-23)19(24)15-12-9-10-13-16(15)20(18)25;/h9-10,12-13H,3-8,11,14H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride?
3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride has a molecular weight of 375.90 g/mol, XLogP of 0.24, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-nonylbenzo[f]benzotriazol-3-ium-4,9-dione chloride is sourced from PubChem (CID 57392713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).