C21H20F3NO3 — CID 57392771
3-methyl-2-[[3-(4,4,4-trifluorobutoxy)phenoxy]methyl]-1H-quinolin-4-one (PubChem CID 57392771) has the molecular formula C21H20F3NO3 and a molecular weight of 391.39 g/mol. Its IUPAC name is 3-methyl-2-[[3-(4,4,4-trifluorobutoxy)phenoxy]methyl]-1H-quinolin-4-one.
| Compound Name | 3-methyl-2-[[3-(4,4,4-trifluorobutoxy)phenoxy]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 57392771 |
| Molecular Formula | C21H20F3NO3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-methyl-2-[[3-(4,4,4-trifluorobutoxy)phenoxy]methyl]-1H-quinolin-4-one |
| SMILES | Cc1c(COc2cccc(OCCCC(F)(F)F)c2)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C21H20F3NO3/c1-14-19(25-18-9-3-2-8-17(18)20(14)26)13-28-16-7-4-6-15(12-16)27-11-5-10-21(22,23)24/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,25,26) |
| InChIKey | UACHJHSWWVDLLI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|