About 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile
4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile (PubChem CID 57392785) has the molecular formula C21H16N2OS
and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile.
Molecular Properties
| Compound Name | 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile |
| PubChem CID | 57392785 |
| Molecular Formula | C21H16N2OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile |
| SMILES | N#Cc1c2c(c(SCc3ccccc3)[nH]c1=O)CCc1ccccc1-2 |
| InChI | InChI=1S/C21H16N2OS/c22-12-18-19-16-9-5-4-8-15(16)10-11-17(19)21(23-20(18)24)25-13-14-6-2-1-3-7-14/h1-9H,10-11,13H2,(H,23,24) |
| InChIKey | QVUNFYOXAPUVEZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile?
The IUPAC name of 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile (CID 57392785) is 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile.
What is the SMILES notation for 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile?
The canonical SMILES for 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile is N#Cc1c2c(c(SCc3ccccc3)[nH]c1=O)CCc1ccccc1-2.
What is the InChIKey of 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile?
The InChIKey is QVUNFYOXAPUVEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2OS/c22-12-18-19-16-9-5-4-8-15(16)10-11-17(19)21(23-20(18)24)25-13-14-6-2-1-3-7-14/h1-9H,10-11,13H2,(H,23,24).
What are the key properties of 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile?
4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile has a molecular weight of 344.44 g/mol, XLogP of 4.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylsulfanyl-2-oxo-5,6-dihydro-3H-benzo[f]isoquinoline-1-carbonitrile is sourced from PubChem (CID 57392785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).