C19H28N4O2S2 — CID 57392816
N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]cyclohexanesulfonamide (PubChem CID 57392816) has the molecular formula C19H28N4O2S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]cyclohexanesulfonamide.
| Compound Name | N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 57392816 |
| Molecular Formula | C19H28N4O2S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]cyclohexanesulfonamide |
| SMILES | O=S(=O)(NCCCCCNc1nc(-c2ccccn2)cs1)C1CCCCC1 |
| InChI | InChI=1S/C19H28N4O2S2/c24-27(25,16-9-3-1-4-10-16)22-14-7-2-6-13-21-19-23-18(15-26-19)17-11-5-8-12-20-17/h5,8,11-12,15-16,22H,1-4,6-7,9-10,13-14H2,(H,21,23) |
| InChIKey | DUTMVABYYXGZJO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|