About Postia Secoguaianolide
Postia Secoguaianolide (PubChem CID 57392887) has the molecular formula C15H18O4
and a molecular weight of 262.30 g/mol. Its IUPAC name is (4R,5R)-3-methylidene-4-[(2-methyl-5-oxocyclopenten-1-yl)methyl]-5-(2-oxopropyl)oxolan-2-one.
Molecular Properties
| Compound Name | Postia Secoguaianolide |
| PubChem CID | 57392887 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (4R,5R)-3-methylidene-4-[(2-methyl-5-oxocyclopenten-1-yl)methyl]-5-(2-oxopropyl)oxolan-2-one |
| SMILES | CC1=C(C(=O)CC1)C[C@H]2[C@H](OC(=O)C2=C)CC(=O)C |
| InChI | InChI=1S/C15H18O4/c1-8-4-5-13(17)11(8)7-12-10(3)15(18)19-14(12)6-9(2)16/h12,14H,3-7H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | KXHHDVSGKJMOJD-TZMCWYRMSA-N |
| XLogP | 0.80 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 498 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze Postia Secoguaianolide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Postia Secoguaianolide?
The IUPAC name of Postia Secoguaianolide (CID 57392887) is (4R,5R)-3-methylidene-4-[(2-methyl-5-oxocyclopenten-1-yl)methyl]-5-(2-oxopropyl)oxolan-2-one.
What is the SMILES notation for Postia Secoguaianolide?
The canonical SMILES for Postia Secoguaianolide is CC1=C(C(=O)CC1)C[C@H]2[C@H](OC(=O)C2=C)CC(=O)C.
What is the InChIKey of Postia Secoguaianolide?
The InChIKey is KXHHDVSGKJMOJD-TZMCWYRMSA-N. The full InChI is InChI=1S/C15H18O4/c1-8-4-5-13(17)11(8)7-12-10(3)15(18)19-14(12)6-9(2)16/h12,14H,3-7H2,1-2H3/t12-,14-/m1/s1.
What are the key properties of Postia Secoguaianolide?
Postia Secoguaianolide has a molecular weight of 262.30 g/mol, XLogP of 0.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Postia Secoguaianolide is sourced from PubChem (CID 57392887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).