C50H68O6 — CID 57393034
5,11,17,23-tetratert-butyl-26,28-bis(3-hydroxypropoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol (PubChem CID 57393034) has the molecular formula C50H68O6 and a molecular weight of 765.09 g/mol. Its IUPAC name is 5,11,17,23-tetratert-butyl-26,28-bis(3-hydroxypropoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol.
| Compound Name | 5,11,17,23-tetratert-butyl-26,28-bis(3-hydroxypropoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 57393034 |
| Molecular Formula | C50H68O6 |
| Molecular Weight | 765.09 g/mol |
| Exact Mass | 764.50 |
| IUPAC Name | 5,11,17,23-tetratert-butyl-26,28-bis(3-hydroxypropoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,27-diol |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1OCCCO)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1OCCCO)C2 |
| InChI | InChI=1S/C50H68O6/c1-47(2,3)39-23-31-19-35-27-41(49(7,8)9)29-37(45(35)55-17-13-15-51)21-33-25-40(48(4,5)6)26-34(44(33)54)22-38-30-42(50(10,11)12)28-36(20-32(24-39)43(31)53)46(38)56-18-14-16-52/h23-30,51-54H,13-22H2,1-12H3 |
| InChIKey | KKIVUPOWNQVKFU-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.09 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|