C27H25NO2S — CID 57393067
1-[2,3-dimethyl-4-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methoxy]phenyl]-2-methylidenebutan-1-one (PubChem CID 57393067) has the molecular formula C27H25NO2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-[2,3-dimethyl-4-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methoxy]phenyl]-2-methylidenebutan-1-one.
| Compound Name | 1-[2,3-dimethyl-4-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methoxy]phenyl]-2-methylidenebutan-1-one |
|---|---|
| PubChem CID | 57393067 |
| Molecular Formula | C27H25NO2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-[2,3-dimethyl-4-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methoxy]phenyl]-2-methylidenebutan-1-one |
| SMILES | C=C(CC)C(=O)c1ccc(OCc2nc(-c3ccc4ccccc4c3)cs2)c(C)c1C |
| InChI | InChI=1S/C27H25NO2S/c1-5-17(2)27(29)23-12-13-25(19(4)18(23)3)30-15-26-28-24(16-31-26)22-11-10-20-8-6-7-9-21(20)14-22/h6-14,16H,2,5,15H2,1,3-4H3 |
| InChIKey | PTRVIOOYBSCOSA-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|