C25H29NO2 — CID 57393117
(8R,9S,13S,14S,17R)-13-methyl-17-[(E)-2-pyridin-2-ylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 57393117) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-13-methyl-17-[(E)-2-pyridin-2-ylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17R)-13-methyl-17-[(E)-2-pyridin-2-ylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 57393117 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (8R,9S,13S,14S,17R)-13-methyl-17-[(E)-2-pyridin-2-ylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)/C=C/c1ccccn1 |
| InChI | InChI=1S/C25H29NO2/c1-24-12-10-21-20-8-6-19(27)16-17(20)5-7-22(21)23(24)11-14-25(24,28)13-9-18-4-2-3-15-26-18/h2-4,6,8-9,13,15-16,21-23,27-28H,5,7,10-12,14H2,1H3/b13-9+/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | HEZKVYCLXKYPMD-WHAISIIASA-N |
| XLogP | 5.09 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |