About [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate
[(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate (PubChem CID 57393127) has the molecular formula C26H26N2O4
and a molecular weight of 430.50 g/mol. Its IUPAC name is [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate.
Molecular Properties
| Compound Name | [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate |
| PubChem CID | 57393127 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate |
| SMILES | C[C@H](COC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O4/c1-19(27-24(29)21-13-7-3-8-14-21)18-32-26(31)23(17-20-11-5-2-6-12-20)28-25(30)22-15-9-4-10-16-22/h2-16,19,23H,17-18H2,1H3,(H,27,29)(H,28,30)/t19-,23-/m1/s1 |
| InChIKey | OLPSTWWOAPXNKC-AUSIDOKSSA-N |
| XLogP | 3.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate?
The IUPAC name of [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate (CID 57393127) is [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate.
What is the SMILES notation for [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate?
The canonical SMILES for [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate is C[C@H](COC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccccc1)NC(=O)c1ccccc1.
What is the InChIKey of [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate?
The InChIKey is OLPSTWWOAPXNKC-AUSIDOKSSA-N. The full InChI is InChI=1S/C26H26N2O4/c1-19(27-24(29)21-13-7-3-8-14-21)18-32-26(31)23(17-20-11-5-2-6-12-20)28-25(30)22-15-9-4-10-16-22/h2-16,19,23H,17-18H2,1H3,(H,27,29)(H,28,30)/t19-,23-/m1/s1.
What are the key properties of [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate?
[(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate has a molecular weight of 430.50 g/mol, XLogP of 3.39, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-benzamidopropyl] (2R)-2-benzamido-3-phenylpropanoate is sourced from PubChem (CID 57393127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).